C14H12N2O3S2 — CID 106268057
5-cyano-N-(3,4-dihydro-2H-chromen-4-yl)thiophene-2-sulfonamide (PubChem CID 106268057) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-cyano-N-(3,4-dihydro-2H-chromen-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(3,4-dihydro-2H-chromen-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106268057 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-cyano-N-(3,4-dihydro-2H-chromen-4-yl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC2CCOc3ccccc32)s1 |
| InChI | InChI=1S/C14H12N2O3S2/c15-9-10-5-6-14(20-10)21(17,18)16-12-7-8-19-13-4-2-1-3-11(12)13/h1-6,12,16H,7-8H2 |
| InChIKey | PQQVUAXFCHPIHJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |