C10H13BrClNO2S2 — CID 106135049
N-[(3-bromocyclopentyl)methyl]-5-chlorothiophene-2-sulfonamide (PubChem CID 106135049) has the molecular formula C10H13BrClNO2S2 and a molecular weight of 358.71 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106135049 |
| Molecular Formula | C10H13BrClNO2S2 |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(Br)C1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H13BrClNO2S2/c11-8-2-1-7(5-8)6-13-17(14,15)10-4-3-9(12)16-10/h3-4,7-8,13H,1-2,5-6H2 |
| InChIKey | RXMPONTUMTWBNM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|