C11H16ClNO2S2 — CID 106135175
N-[(3-chlorocyclopentyl)methyl]-5-methylthiophene-2-sulfonamide (PubChem CID 106135175) has the molecular formula C11H16ClNO2S2 and a molecular weight of 293.84 g/mol. Its IUPAC name is N-[(3-chlorocyclopentyl)methyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[(3-chlorocyclopentyl)methyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106135175 |
| Molecular Formula | C11H16ClNO2S2 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-[(3-chlorocyclopentyl)methyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCC(Cl)C2)s1 |
| InChI | InChI=1S/C11H16ClNO2S2/c1-8-2-5-11(16-8)17(14,15)13-7-9-3-4-10(12)6-9/h2,5,9-10,13H,3-4,6-7H2,1H3 |
| InChIKey | NZSCJGDOPLBPIP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|