C10H12Cl2N2O2S — CID 43597819
N-(3-aminocyclobutyl)-2,3-dichlorobenzenesulfonamide (PubChem CID 43597819) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 43597819 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | N-(3-aminocyclobutyl)-2,3-dichlorobenzenesulfonamide |
| SMILES | NC1CC(NS(=O)(=O)c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c11-8-2-1-3-9(10(8)12)17(15,16)14-7-4-6(13)5-7/h1-3,6-7,14H,4-5,13H2 |
| InChIKey | TVTMPRZPIMNWLC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |