C12H16F2N2O2S — CID 114695279
2,6-difluoro-N-(2-methylpiperidin-3-yl)benzenesulfonamide (PubChem CID 114695279) has the molecular formula C12H16F2N2O2S and a molecular weight of 290.33 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-methylpiperidin-3-yl)benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-(2-methylpiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114695279 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2,6-difluoro-N-(2-methylpiperidin-3-yl)benzenesulfonamide |
| SMILES | CC1NCCCC1NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C12H16F2N2O2S/c1-8-11(6-3-7-15-8)16-19(17,18)12-9(13)4-2-5-10(12)14/h2,4-5,8,11,15-16H,3,6-7H2,1H3 |
| InChIKey | GJERQHODWHYRLX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |