C15H23N3O4S2 — CID 120726415
1-N-cyclopropyl-3-N-(2-methylpiperidin-3-yl)benzene-1,3-disulfonamide (PubChem CID 120726415) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-N-cyclopropyl-3-N-(2-methylpiperidin-3-yl)benzene-1,3-disulfonamide.
| Compound Name | 1-N-cyclopropyl-3-N-(2-methylpiperidin-3-yl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 120726415 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-N-cyclopropyl-3-N-(2-methylpiperidin-3-yl)benzene-1,3-disulfonamide |
| SMILES | CC1NCCCC1NS(=O)(=O)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-11-15(6-3-9-16-11)18-24(21,22)14-5-2-4-13(10-14)23(19,20)17-12-7-8-12/h2,4-5,10-12,15-18H,3,6-9H2,1H3 |
| InChIKey | AKAMQKGTFRUIMC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |