C28H38O2Si — CID 154601605
tert-butyl-dimethyl-[(E)-8-(2-phenyl-1-benzofuran-6-yl)oct-4-enoxy]silane (PubChem CID 154601605) has the molecular formula C28H38O2Si and a molecular weight of 434.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-8-(2-phenyl-1-benzofuran-6-yl)oct-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-8-(2-phenyl-1-benzofuran-6-yl)oct-4-enoxy]silane |
|---|---|
| PubChem CID | 154601605 |
| Molecular Formula | C28H38O2Si |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-8-(2-phenyl-1-benzofuran-6-yl)oct-4-enoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/CCCc1ccc2cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C28H38O2Si/c1-28(2,3)31(4,5)29-20-14-9-7-6-8-11-15-23-18-19-25-22-27(30-26(25)21-23)24-16-12-10-13-17-24/h6-7,10,12-13,16-19,21-22H,8-9,11,14-15,20H2,1-5H3/b7-6+ |
| InChIKey | BGJNXHQQWDADSX-VOTSOKGWSA-N |
| XLogP | 8.78 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|