C33H48O2SSi — CID 154601598
tert-butyl-dimethyl-[(E)-8-[[2-(4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]oct-4-enoxy]silane (PubChem CID 154601598) has the molecular formula C33H48O2SSi and a molecular weight of 536.90 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-8-[[2-(4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]oct-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-8-[[2-(4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]oct-4-enoxy]silane |
|---|---|
| PubChem CID | 154601598 |
| Molecular Formula | C33H48O2SSi |
| Molecular Weight | 536.90 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-8-[[2-(4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]oct-4-enoxy]silane |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCCC/C=C/CCCO[Si](C)(C)C(C)(C)C)cc3o2)cc1 |
| InChI | InChI=1S/C33H48O2SSi/c1-7-8-13-16-27-17-19-28(20-18-27)31-25-29-21-22-30(26-32(29)35-31)36-24-15-12-10-9-11-14-23-34-37(5,6)33(2,3)4/h9-10,17-22,25-26H,7-8,11-16,23-24H2,1-6H3/b10-9+ |
| InChIKey | LRAVWNBSQMKDSR-MDZDMXLPSA-N |
| XLogP | 11.06 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.90 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|