C27H32OS — CID 154601606
6-[(4E)-octa-4,7-dienyl]sulfanyl-2-(4-pentylphenyl)-1-benzofuran (PubChem CID 154601606) has the molecular formula C27H32OS and a molecular weight of 404.62 g/mol. Its IUPAC name is 6-[(4E)-octa-4,7-dienyl]sulfanyl-2-(4-pentylphenyl)-1-benzofuran.
| Compound Name | 6-[(4E)-octa-4,7-dienyl]sulfanyl-2-(4-pentylphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 154601606 |
| Molecular Formula | C27H32OS |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 6-[(4E)-octa-4,7-dienyl]sulfanyl-2-(4-pentylphenyl)-1-benzofuran |
| SMILES | C=CC/C=C/CCCSc1ccc2cc(-c3ccc(CCCCC)cc3)oc2c1 |
| InChI | InChI=1S/C27H32OS/c1-3-5-7-8-9-11-19-29-25-18-17-24-20-26(28-27(24)21-25)23-15-13-22(14-16-23)12-10-6-4-2/h3,7-8,13-18,20-21H,1,4-6,9-12,19H2,2H3/b8-7+ |
| InChIKey | QJGZMPZROKQVKH-BQYQJAHWSA-N |
| XLogP | 8.84 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|