C15H12O3 — CID 135043318
1-phenyl-6-prop-2-ynoxyhex-3-yne-1,2-dione (PubChem CID 135043318) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-phenyl-6-prop-2-ynoxyhex-3-yne-1,2-dione.
| Compound Name | 1-phenyl-6-prop-2-ynoxyhex-3-yne-1,2-dione |
|---|---|
| PubChem CID | 135043318 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-phenyl-6-prop-2-ynoxyhex-3-yne-1,2-dione |
| SMILES | C#CCOCCC#CC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12O3/c1-2-11-18-12-7-6-10-14(16)15(17)13-8-4-3-5-9-13/h1,3-5,8-9H,7,11-12H2 |
| InChIKey | ZIWIOUFUZVARCS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|