C33H48O3Si — CID 10918377
[(2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-yn-4-yl] benzoate (PubChem CID 10918377) has the molecular formula C33H48O3Si and a molecular weight of 520.83 g/mol. Its IUPAC name is [(2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-yn-4-yl] benzoate.
| Compound Name | [(2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-yn-4-yl] benzoate |
|---|---|
| PubChem CID | 10918377 |
| Molecular Formula | C33H48O3Si |
| Molecular Weight | 520.83 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | [(2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-yn-4-yl] benzoate |
| SMILES | CC1=C(C/C=C(\C)C(C#C/C(C)=C\CO[Si](C)(C)C(C)(C)C)OC(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C33H48O3Si/c1-25(22-24-35-37(9,10)32(4,5)6)18-21-30(36-31(34)28-16-12-11-13-17-28)27(3)19-20-29-26(2)15-14-23-33(29,7)8/h11-13,16-17,19,22,30H,14-15,20,23-24H2,1-10H3/b25-22-,27-19+ |
| InChIKey | NRNGZQSSISGOEV-NCKLNCOMSA-N |
| XLogP | 9.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.83 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|