C23H26O3S — CID 1045417
[2-(benzenesulfinylmethyl)-3,3-dimethylcyclohexen-1-yl]methyl benzoate (PubChem CID 1045417) has the molecular formula C23H26O3S and a molecular weight of 382.52 g/mol. Its IUPAC name is [2-(benzenesulfinylmethyl)-3,3-dimethylcyclohexen-1-yl]methyl benzoate.
| Compound Name | [2-(benzenesulfinylmethyl)-3,3-dimethylcyclohexen-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 1045417 |
| Molecular Formula | C23H26O3S |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2-(benzenesulfinylmethyl)-3,3-dimethylcyclohexen-1-yl]methyl benzoate |
| SMILES | CC1(C)CCCC(COC(=O)c2ccccc2)=C1CS(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26O3S/c1-23(2)15-9-12-19(16-26-22(24)18-10-5-3-6-11-18)21(23)17-27(25)20-13-7-4-8-14-20/h3-8,10-11,13-14H,9,12,15-17H2,1-2H3 |
| InChIKey | GJWGHPLDLXTFDJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|