C23H23NO2 — CID 10246979
[2-(1-methylindol-2-yl)cyclohexen-1-yl]methyl benzoate (PubChem CID 10246979) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is [2-(1-methylindol-2-yl)cyclohexen-1-yl]methyl benzoate.
| Compound Name | [2-(1-methylindol-2-yl)cyclohexen-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 10246979 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [2-(1-methylindol-2-yl)cyclohexen-1-yl]methyl benzoate |
| SMILES | Cn1c(C2=C(COC(=O)c3ccccc3)CCCC2)cc2ccccc21 |
| InChI | InChI=1S/C23H23NO2/c1-24-21-14-8-6-11-18(21)15-22(24)20-13-7-5-12-19(20)16-26-23(25)17-9-3-2-4-10-17/h2-4,6,8-11,14-15H,5,7,12-13,16H2,1H3 |
| InChIKey | GTTTZLCMBJGJDF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |