C38H77NO5Si2Sn — CID 177496074
[(1E,5S,6S,7E,9S)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxo-1-tributylstannyltrideca-1,7-dien-5-yl] carbamate (PubChem CID 177496074) has the molecular formula C38H77NO5Si2Sn and a molecular weight of 802.92 g/mol. Its IUPAC name is [(1E,5S,6S,7E,9S)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxo-1-tributylstannyltrideca-1,7-dien-5-yl] carbamate.
| Compound Name | [(1E,5S,6S,7E,9S)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxo-1-tributylstannyltrideca-1,7-dien-5-yl] carbamate |
|---|---|
| PubChem CID | 177496074 |
| Molecular Formula | C38H77NO5Si2Sn |
| Molecular Weight | 802.92 g/mol |
| Exact Mass | 803.44 |
| IUPAC Name | [(1E,5S,6S,7E,9S)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-13-oxo-1-tributylstannyltrideca-1,7-dien-5-yl] carbamate |
| SMILES | CCCC[Sn](/C=C/CC[C@H](OC(N)=O)[C@H](/C=C/[C@H](CCCC=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C26H50NO5Si2.3C4H9.Sn/c1-12-13-17-22(30-24(27)29)23(32-34(10,11)26(5,6)7)19-18-21(16-14-15-20-28)31-33(8,9)25(2,3)4;3*1-3-4-2;/h1,12,18-23H,13-17H2,2-11H3,(H2,27,29);3*1,3-4H2,2H3;/b12-1?,19-18+;;;;/t21-,22-,23-;;;;/m0..../s1 |
| InChIKey | XZFDVPQTCSAREV-DLCOJMPSSA-N |
| XLogP | 11.88 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.92 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|