C23H44O5Si — CID 25180725
2-[(4S,6S)-6-[(2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-5-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]acetic acid (PubChem CID 25180725) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is 2-[(4S,6S)-6-[(2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-5-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]acetic acid.
| Compound Name | 2-[(4S,6S)-6-[(2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-5-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 25180725 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 2-[(4S,6S)-6-[(2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhex-5-en-2-yl]-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]acetic acid |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H]1OC(C)(C)O[C@@H](CC(=O)O)C1(C)C |
| InChI | InChI=1S/C23H44O5Si/c1-13-15(2)19(28-29(11,12)21(4,5)6)16(3)20-22(7,8)17(14-18(24)25)26-23(9,10)27-20/h13,15-17,19-20H,1,14H2,2-12H3,(H,24,25)/t15-,16+,17-,19-,20-/m0/s1 |
| InChIKey | CSOYKSLAPHLOTL-VYMYIBDJSA-N |
| XLogP | 5.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|