C28H44O5 — CID 10582661
propan-2-yl 2-[(4S,6R)-2,2,5,5-tetramethyl-6-[(2R,3S,4S)-4-methyl-3-phenylmethoxyhept-6-en-2-yl]-1,3-dioxan-4-yl]acetate (PubChem CID 10582661) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is propan-2-yl 2-[(4S,6R)-2,2,5,5-tetramethyl-6-[(2R,3S,4S)-4-methyl-3-phenylmethoxyhept-6-en-2-yl]-1,3-dioxan-4-yl]acetate.
| Compound Name | propan-2-yl 2-[(4S,6R)-2,2,5,5-tetramethyl-6-[(2R,3S,4S)-4-methyl-3-phenylmethoxyhept-6-en-2-yl]-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 10582661 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | propan-2-yl 2-[(4S,6R)-2,2,5,5-tetramethyl-6-[(2R,3S,4S)-4-methyl-3-phenylmethoxyhept-6-en-2-yl]-1,3-dioxan-4-yl]acetate |
| SMILES | C=CC[C@H](C)[C@H](OCc1ccccc1)[C@@H](C)[C@H]1OC(C)(C)O[C@@H](CC(=O)OC(C)C)C1(C)C |
| InChI | InChI=1S/C28H44O5/c1-10-14-20(4)25(30-18-22-15-12-11-13-16-22)21(5)26-27(6,7)23(32-28(8,9)33-26)17-24(29)31-19(2)3/h10-13,15-16,19-21,23,25-26H,1,14,17-18H2,2-9H3/t20-,21+,23-,25-,26+/m0/s1 |
| InChIKey | ZQNALIMGPZBXDT-SCKNTPHJSA-N |
| XLogP | 6.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|