C25H52O9Si2 — CID 11103628
(4S,5R)-5-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 11103628) has the molecular formula C25H52O9Si2 and a molecular weight of 552.85 g/mol. Its IUPAC name is (4S,5R)-5-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4S,5R)-5-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 11103628 |
| Molecular Formula | C25H52O9Si2 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | (4S,5R)-5-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)propyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | COCCOCOC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C25H52O9Si2/c1-23(2,3)35(10,11)33-18(16-30-17-29-15-14-28-9)19(34-36(12,13)24(4,5)6)20-21(22(26)27)32-25(7,8)31-20/h18-21H,14-17H2,1-13H3,(H,26,27)/t18-,19+,20-,21-/m0/s1 |
| InChIKey | QUFDHQWWOBELEM-WOZUAGRISA-N |
| XLogP | 5.01 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|