C36H66O6Si — CID 11250587
(5S,6S,8E,11R,12S,14E,16R)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-6,8,12,14-tetramethyl-16-[(7R,9R)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]heptadeca-8,14-dienoic acid (PubChem CID 11250587) has the molecular formula C36H66O6Si and a molecular weight of 623.00 g/mol. Its IUPAC name is (5S,6S,8E,11R,12S,14E,16R)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-6,8,12,14-tetramethyl-16-[(7R,9R)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]heptadeca-8,14-dienoic acid.
| Compound Name | (5S,6S,8E,11R,12S,14E,16R)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-6,8,12,14-tetramethyl-16-[(7R,9R)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]heptadeca-8,14-dienoic acid |
|---|---|
| PubChem CID | 11250587 |
| Molecular Formula | C36H66O6Si |
| Molecular Weight | 623.00 g/mol |
| Exact Mass | 622.46 |
| IUPAC Name | (5S,6S,8E,11R,12S,14E,16R)-5-[tert-butyl(dimethyl)silyl]oxy-11-hydroxy-6,8,12,14-tetramethyl-16-[(7R,9R)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]heptadeca-8,14-dienoic acid |
| SMILES | C/C(=C\[C@@H](C)[C@H]1C[C@@H](C)OC2(CCCC2)O1)C[C@H](C)[C@H](O)C/C=C(\C)C[C@H](C)[C@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H66O6Si/c1-25(21-28(4)32(15-14-16-34(38)39)42-43(10,11)35(7,8)9)17-18-31(37)27(3)22-26(2)23-29(5)33-24-30(6)40-36(41-33)19-12-13-20-36/h17,23,27-33,37H,12-16,18-22,24H2,1-11H3,(H,38,39)/b25-17+,26-23+/t27-,28-,29+,30+,31+,32-,33+/m0/s1 |
| InChIKey | ZWIYGYQJQKTEMK-ONVJPEOESA-N |
| XLogP | 9.43 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.00 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|