C13H24O5Si — CID 101495893
7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhept-5-ynoic acid (PubChem CID 101495893) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhept-5-ynoic acid.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhept-5-ynoic acid |
|---|---|
| PubChem CID | 101495893 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxyhept-5-ynoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC(O)C(O)CC(=O)O |
| InChI | InChI=1S/C13H24O5Si/c1-13(2,3)19(4,5)18-8-6-7-10(14)11(15)9-12(16)17/h10-11,14-15H,8-9H2,1-5H3,(H,16,17) |
| InChIKey | FRGQHPZBAMPCHJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|