C18H40O7Si — CID 159450631
methane;methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanoate;methyl (3S)-3,4-dihydroxybutanoate (PubChem CID 159450631) has the molecular formula C18H40O7Si and a molecular weight of 396.60 g/mol. Its IUPAC name is methane;methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanoate;methyl (3S)-3,4-dihydroxybutanoate.
| Compound Name | methane;methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanoate;methyl (3S)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 159450631 |
| Molecular Formula | C18H40O7Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | methane;methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanoate;methyl (3S)-3,4-dihydroxybutanoate |
| SMILES | C.CC[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C.COC(=O)C[C@H](O)CO |
| InChI | InChI=1S/C12H26O3Si.C5H10O4.CH4/c1-8-10(9-11(13)14-5)15-16(6,7)12(2,3)4;1-9-5(8)2-4(7)3-6;/h10H,8-9H2,1-7H3;4,6-7H,2-3H2,1H3;1H4/t10-;4-;/m10./s1 |
| InChIKey | LTICTXWGIZZCFH-RUFWJCNMSA-N |
| XLogP | 2.89 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|