About butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline
butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline (PubChem CID 143095074) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline.
Molecular Properties
| Compound Name | butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline |
| PubChem CID | 143095074 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline |
| SMILES | CCCCO.Cc1ccc(CCOc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C17H16N2O.C4H10O/c1-13-6-8-14(9-7-13)10-11-20-17-15-4-2-3-5-16(15)18-12-19-17;1-2-3-4-5/h2-9,12H,10-11H2,1H3;5H,2-4H2,1H3 |
| InChIKey | WEZGLEQMMHWWAO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline?
The IUPAC name of butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline (CID 143095074) is butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline.
What is the SMILES notation for butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline?
The canonical SMILES for butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline is CCCCO.Cc1ccc(CCOc2ncnc3ccccc23)cc1.
What is the InChIKey of butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline?
The InChIKey is WEZGLEQMMHWWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O.C4H10O/c1-13-6-8-14(9-7-13)10-11-20-17-15-4-2-3-5-16(15)18-12-19-17;1-2-3-4-5/h2-9,12H,10-11H2,1H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline?
butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline has a molecular weight of 338.45 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;4-[2-(4-methylphenyl)ethoxy]quinazoline is sourced from PubChem (CID 143095074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).