C23H28O7S — CID 22418852
tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 22418852) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 22418852 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-3-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(Cc2cccc3c2OCCO3)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H28O7S/c1-16-8-10-19(11-9-16)31(25,26)29-15-18(22(24)30-23(2,3)4)14-17-6-5-7-20-21(17)28-13-12-27-20/h5-11,18H,12-15H2,1-4H3 |
| InChIKey | WRWJRXVHHGZVNR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|