C36H39N5O5Si — CID 161197603
N-[9-[(1R,2R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1,2-dihydroxyethyl]-5-methyl-3-oxabicyclo[3.1.0]hexan-2-yl]purin-6-yl]benzamide (PubChem CID 161197603) has the molecular formula C36H39N5O5Si and a molecular weight of 649.82 g/mol. Its IUPAC name is N-[9-[(1R,2R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1,2-dihydroxyethyl]-5-methyl-3-oxabicyclo[3.1.0]hexan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1R,2R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1,2-dihydroxyethyl]-5-methyl-3-oxabicyclo[3.1.0]hexan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 161197603 |
| Molecular Formula | C36H39N5O5Si |
| Molecular Weight | 649.82 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | N-[9-[(1R,2R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1,2-dihydroxyethyl]-5-methyl-3-oxabicyclo[3.1.0]hexan-2-yl]purin-6-yl]benzamide |
| SMILES | CC(C)(C)[Si](O[C@]12C[C@@]1(C)[C@@H]([C@@H](O)CO)O[C@H]2n1cnc2c(NC(=O)c3ccccc3)ncnc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39N5O5Si/c1-34(2,3)47(25-16-10-6-11-17-25,26-18-12-7-13-19-26)46-36-21-35(36,4)29(27(43)20-42)45-33(36)41-23-39-28-30(37-22-38-31(28)41)40-32(44)24-14-8-5-9-15-24/h5-19,22-23,27,29,33,42-43H,20-21H2,1-4H3,(H,37,38,40,44)/t27-,29+,33+,35-,36-/m0/s1 |
| InChIKey | DHJOQAATZSUCAA-HAWKLBBZSA-N |
| XLogP | 4.05 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|