C31H30N4O7 — CID 163296309
9-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione (PubChem CID 163296309) has the molecular formula C31H30N4O7 and a molecular weight of 570.60 g/mol. Its IUPAC name is 9-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione.
| Compound Name | 9-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 163296309 |
| Molecular Formula | C31H30N4O7 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 9-[(2R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3c(=O)[nH]c4c(=O)[nH]cnc43)C[C@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H30N4O7/c1-39-22-12-8-20(9-13-22)31(19-6-4-3-5-7-19,21-10-14-23(40-2)15-11-21)41-17-25-24(36)16-26(42-25)35-28-27(34-30(35)38)29(37)33-18-32-28/h3-15,18,24-26,36H,16-17H2,1-2H3,(H,34,38)(H,32,33,37)/t24-,25-,26-/m1/s1 |
| InChIKey | RBFYDBSYAPBZNW-TWJOJJKGSA-N |
| XLogP | 3.09 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|