C37H33FN6O6 — CID 135312780
N-[3-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide (PubChem CID 135312780) has the molecular formula C37H33FN6O6 and a molecular weight of 676.71 g/mol. Its IUPAC name is N-[3-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide.
| Compound Name | N-[3-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 135312780 |
| Molecular Formula | C37H33FN6O6 |
| Molecular Weight | 676.71 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | N-[3-[(2R,3S,4R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]triazolo[4,5-d]pyrimidin-7-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@@H]2O[C@@H](n3nnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H](F)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H33FN6O6/c1-47-27-17-13-25(14-18-27)37(24-11-7-4-8-12-24,26-15-19-28(48-2)20-16-26)49-21-29-32(45)30(38)36(50-29)44-34-31(42-43-44)33(39-22-40-34)41-35(46)23-9-5-3-6-10-23/h3-20,22,29-30,32,36,45H,21H2,1-2H3,(H,39,40,41,46)/t29-,30-,32+,36+/m0/s1 |
| InChIKey | WNVHABIJKVPLTQ-YHLBNOBUSA-N |
| XLogP | 5.10 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|