About N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide
N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 156542768) has the molecular formula C23H27N7O2
and a molecular weight of 433.52 g/mol. Its IUPAC name is N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide.
Molecular Properties
| Compound Name | N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide |
| PubChem CID | 156542768 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2C1CCC(CN2CCC3(CNC3)C2)O1)c1ccccc1 |
| InChI | InChI=1S/C23H27N7O2/c31-22(16-4-2-1-3-5-16)28-20-19-21(26-14-25-20)30(15-27-19)18-7-6-17(32-18)10-29-9-8-23(13-29)11-24-12-23/h1-5,14-15,17-18,24H,6-13H2,(H,25,26,28,31) |
| InChIKey | QOMWLHJNXWWGBL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide?
The IUPAC name of N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide (CID 156542768) is N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide.
What is the SMILES notation for N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide?
The canonical SMILES for N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide is O=C(Nc1ncnc2c1ncn2C1CCC(CN2CCC3(CNC3)C2)O1)c1ccccc1.
What is the InChIKey of N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide?
The InChIKey is QOMWLHJNXWWGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N7O2/c31-22(16-4-2-1-3-5-16)28-20-19-21(26-14-25-20)30(15-27-19)18-7-6-17(32-18)10-29-9-8-23(13-29)11-24-12-23/h1-5,14-15,17-18,24H,6-13H2,(H,25,26,28,31).
What are the key properties of N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide?
N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide has a molecular weight of 433.52 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9-[5-(2,6-diazaspiro[3.4]octan-6-ylmethyl)oxolan-2-yl]purin-6-yl]benzamide is sourced from PubChem (CID 156542768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).