C10H11F2N5O2 — CID 70294458
[(3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-fluorooxolan-3-yl]methanol (PubChem CID 70294458) has the molecular formula C10H11F2N5O2 and a molecular weight of 271.23 g/mol. Its IUPAC name is [(3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-fluorooxolan-3-yl]methanol.
| Compound Name | [(3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-fluorooxolan-3-yl]methanol |
|---|---|
| PubChem CID | 70294458 |
| Molecular Formula | C10H11F2N5O2 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [(3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-fluorooxolan-3-yl]methanol |
| SMILES | Nc1nc(F)nc2c1ncn2[C@H]1C[C@@](F)(CO)CO1 |
| InChI | InChI=1S/C10H11F2N5O2/c11-9-15-7(13)6-8(16-9)17(4-14-6)5-1-10(12,2-18)3-19-5/h4-5,18H,1-3H2,(H2,13,15,16)/t5-,10-/m1/s1 |
| InChIKey | FDJHFCSCWTZAER-GPXNAGAYSA-N |
| XLogP | 0.17 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |