C12H13FN5O3P — CID 166551463
[5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methoxyphosphinous acid (PubChem CID 166551463) has the molecular formula C12H13FN5O3P and a molecular weight of 325.24 g/mol. Its IUPAC name is [5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methoxyphosphinous acid.
| Compound Name | [5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methoxyphosphinous acid |
|---|---|
| PubChem CID | 166551463 |
| Molecular Formula | C12H13FN5O3P |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methoxyphosphinous acid |
| SMILES | C#CC1(COPO)CCC(n2cnc3c(N)nc(F)nc32)O1 |
| InChI | InChI=1S/C12H13FN5O3P/c1-2-12(5-20-22-19)4-3-7(21-12)18-6-15-8-9(14)16-11(13)17-10(8)18/h1,6-7,19,22H,3-5H2,(H2,14,16,17) |
| InChIKey | YKLRTVKHZLXYIR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|