C24H30FN5O8Si — CID 163362550
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] (5-methyl-2-oxo-1,3-dioxolan-4-ylidene)methyl carbonate (PubChem CID 163362550) has the molecular formula C24H30FN5O8Si and a molecular weight of 563.62 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] (5-methyl-2-oxo-1,3-dioxolan-4-ylidene)methyl carbonate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] (5-methyl-2-oxo-1,3-dioxolan-4-ylidene)methyl carbonate |
|---|---|
| PubChem CID | 163362550 |
| Molecular Formula | C24H30FN5O8Si |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] (5-methyl-2-oxo-1,3-dioxolan-4-ylidene)methyl carbonate |
| SMILES | C#C[C@]1(CO[Si](C)(C)C(C)(C)C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)OC=C1OC(=O)OC1C |
| InChI | InChI=1S/C24H30FN5O8Si/c1-8-24(11-34-39(6,7)23(3,4)5)15(37-21(31)33-10-14-13(2)35-22(32)36-14)9-16(38-24)30-12-27-17-18(26)28-20(25)29-19(17)30/h1,10,12-13,15-16H,9,11H2,2-7H3,(H2,26,28,29)/t13?,15-,16+,24+/m0/s1 |
| InChIKey | UWEQQUXNTUHUSY-XWSGLVPISA-N |
| XLogP | 3.78 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|