C24H32F2N7O6PS — CID 158083903
ethyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 158083903) has the molecular formula C24H32F2N7O6PS and a molecular weight of 615.60 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 158083903 |
| Molecular Formula | C24H32F2N7O6PS |
| Molecular Weight | 615.60 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | ethyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N[P@](=S)(OC[C@@]1(F)O[C@@H](n2cnc3c(N(C)N)nc(C)nc32)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H32F2N7O6PS/c1-6-36-20(34)14(2)31-40(41,39-16-10-8-7-9-11-16)37-12-24(26)21(35)23(4,25)22(38-24)33-13-28-17-18(32(5)27)29-15(3)30-19(17)33/h7-11,13-14,21-22,35H,6,12,27H2,1-5H3,(H,31,41)/t14-,21+,22-,23-,24-,40+/m1/s1 |
| InChIKey | ZUPPCGLGQXUQTG-XLHWBURVSA-N |
| XLogP | 2.59 |
| TPSA | 159.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|