C32H41F2N6O7P — CID 157088963
2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 157088963) has the molecular formula C32H41F2N6O7P and a molecular weight of 690.69 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 157088963 |
| Molecular Formula | C32H41F2N6O7P |
| Molecular Weight | 690.69 g/mol |
| Exact Mass | 690.27 |
| IUPAC Name | 2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc(N(C)C)c2ncn([C@@H]3O[C@](F)(CO[P@](=O)(N[C@H](C)C(=O)OCC(C)(C)C)Oc4cccc5ccccc45)[C@@H](O)[C@@]3(C)F)c2n1 |
| InChI | InChI=1S/C32H41F2N6O7P/c1-19(27(41)44-16-30(3,4)5)38-48(43,47-23-15-11-13-21-12-9-10-14-22(21)23)45-17-32(34)28(42)31(6,33)29(46-32)40-18-35-24-25(39(7)8)36-20(2)37-26(24)40/h9-15,18-19,28-29,42H,16-17H2,1-8H3,(H,38,43)/t19-,28+,29-,31-,32-,48-/m1/s1 |
| InChIKey | SOLQUCHHMCXPEH-UGCCEJIBSA-N |
| XLogP | 5.41 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|