C11H12F2N6O4 — CID 57039161
N-[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide (PubChem CID 57039161) has the molecular formula C11H12F2N6O4 and a molecular weight of 330.25 g/mol. Its IUPAC name is N-[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide.
| Compound Name | N-[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide |
|---|---|
| PubChem CID | 57039161 |
| Molecular Formula | C11H12F2N6O4 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[2-amino-9-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide |
| SMILES | Nc1nc(NC=O)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)C3(F)F)c2n1 |
| InChI | InChI=1S/C11H12F2N6O4/c12-11(13)6(22)4(1-20)23-9(11)19-2-15-5-7(16-3-21)17-10(14)18-8(5)19/h2-4,6,9,20,22H,1H2,(H3,14,16,17,18,21)/t4-,6-,9-/m1/s1 |
| InChIKey | VBXFSUDJOUWJMM-NVMQTXNBSA-N |
| XLogP | -1.14 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|