C20H22ClN5O5 — CID 57152125
(2R,5R)-2-[2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57152125) has the molecular formula C20H22ClN5O5 and a molecular weight of 447.88 g/mol. Its IUPAC name is (2R,5R)-2-[2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57152125 |
| Molecular Formula | C20H22ClN5O5 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2R,5R)-2-[2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NOC4CCCc5ccccc54)nc(Cl)nc32)C(O)C1O |
| InChI | InChI=1S/C20H22ClN5O5/c21-20-23-17(25-31-12-7-3-5-10-4-1-2-6-11(10)12)14-18(24-20)26(9-22-14)19-16(29)15(28)13(8-27)30-19/h1-2,4,6,9,12-13,15-16,19,27-29H,3,5,7-8H2,(H,23,24,25)/t12?,13-,15?,16?,19-/m1/s1 |
| InChIKey | ZVIPVFYOHIIKSZ-YHVDPHMJSA-N |
| XLogP | 1.51 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|