C28H41N5O8Si2 — CID 100990396
(6aR,8R,9R,9aS)-8-[6-(2-nitrophenoxy)purin-9-yl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 100990396) has the molecular formula C28H41N5O8Si2 and a molecular weight of 631.84 g/mol. Its IUPAC name is (6aR,8R,9R,9aS)-8-[6-(2-nitrophenoxy)purin-9-yl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8R,9R,9aS)-8-[6-(2-nitrophenoxy)purin-9-yl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 100990396 |
| Molecular Formula | C28H41N5O8Si2 |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | (6aR,8R,9R,9aS)-8-[6-(2-nitrophenoxy)purin-9-yl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(Oc5ccccc5[N+](=O)[O-])ncnc43)[C@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C28H41N5O8Si2/c1-16(2)42(17(3)4)37-13-22-25(40-43(41-42,18(5)6)19(7)8)24(34)28(39-22)32-15-31-23-26(32)29-14-30-27(23)38-21-12-10-9-11-20(21)33(35)36/h9-12,14-19,22,24-25,28,34H,13H2,1-8H3/t22-,24-,25-,28-/m1/s1 |
| InChIKey | PXZBOPJVHVXQOT-ZYWWQZICSA-N |
| XLogP | 5.74 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|