C10H9Cl3N4O3 — CID 91036147
(2R,3S)-2-(hydroxymethyl)-5-(2,6,8-trichloropurin-1-yl)oxolan-3-ol (PubChem CID 91036147) has the molecular formula C10H9Cl3N4O3 and a molecular weight of 339.57 g/mol. Its IUPAC name is (2R,3S)-2-(hydroxymethyl)-5-(2,6,8-trichloropurin-1-yl)oxolan-3-ol.
| Compound Name | (2R,3S)-2-(hydroxymethyl)-5-(2,6,8-trichloropurin-1-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 91036147 |
| Molecular Formula | C10H9Cl3N4O3 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | (2R,3S)-2-(hydroxymethyl)-5-(2,6,8-trichloropurin-1-yl)oxolan-3-ol |
| SMILES | OC[C@H]1OC(n2c(Cl)nc3nc(Cl)nc-3c2Cl)C[C@@H]1O |
| InChI | InChI=1S/C10H9Cl3N4O3/c11-7-6-8(15-9(12)14-6)16-10(13)17(7)5-1-3(19)4(2-18)20-5/h3-5,18-19H,1-2H2/t3-,4+,5?/m0/s1 |
| InChIKey | NMICYPMLSGOJKA-PYHARJCCSA-N |
| XLogP | 1.38 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |