C15H20N9O8P — CID 174588439
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;7H-purine (PubChem CID 174588439) has the molecular formula C15H20N9O8P and a molecular weight of 485.35 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;7H-purine.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;7H-purine |
|---|---|
| PubChem CID | 174588439 |
| Molecular Formula | C15H20N9O8P |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;7H-purine |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=P(O)(O)O.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C10H13N5O4.C5H4N4.H3O4P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-4-5(8-2-6-1)9-3-7-4;1-5(2,3)4/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);1-3H,(H,6,7,8,9);(H3,1,2,3,4)/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | GOEPEVJBKXXDDW-IDIVVRGQSA-N |
| XLogP | -2.56 |
| TPSA | 271.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|