C15H18N10O4 — CID 157386194
(2R,3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;7H-purine (PubChem CID 157386194) has the molecular formula C15H18N10O4 and a molecular weight of 402.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;7H-purine.
| Compound Name | (2R,3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;7H-purine |
|---|---|
| PubChem CID | 157386194 |
| Molecular Formula | C15H18N10O4 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;7H-purine |
| SMILES | Nc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C10H14N6O4.C5H4N4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9;1-4-5(8-2-6-1)9-3-7-4/h2-3,5-6,9,17-19H,1H2,(H4,11,12,14,15);1-3H,(H,6,7,8,9)/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | BLLONRMRTLWHRE-GWTDSMLYSA-N |
| XLogP | -2.04 |
| TPSA | 220.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |