C15H21N10O9P — CID 172838273
2-amino-1,7-dihydropurin-6-one;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid (PubChem CID 172838273) has the molecular formula C15H21N10O9P and a molecular weight of 516.37 g/mol. Its IUPAC name is 2-amino-1,7-dihydropurin-6-one;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid.
| Compound Name | 2-amino-1,7-dihydropurin-6-one;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid |
|---|---|
| PubChem CID | 172838273 |
| Molecular Formula | C15H21N10O9P |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 2-amino-1,7-dihydropurin-6-one;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid |
| SMILES | Nc1nc2nc[nH]c2c(=O)[nH]1.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=P(O)(O)O |
| InChI | InChI=1S/C10H13N5O4.C5H5N5O.H3O4P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;6-5-9-3-2(4(11)10-5)7-1-8-3;1-5(2,3)4/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);1H,(H4,6,7,8,9,10,11);(H3,1,2,3,4)/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | WLIRUSUCIFERFL-IDIVVRGQSA-N |
| XLogP | -3.68 |
| TPSA | 317.75 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|