C9H10N4O3Se — CID 136826771
9-[(2R,5R)-2-(hydroxymethyl)-1,3-oxaselenolan-5-yl]-1H-purin-6-one (PubChem CID 136826771) has the molecular formula C9H10N4O3Se and a molecular weight of 301.16 g/mol. Its IUPAC name is 9-[(2R,5R)-2-(hydroxymethyl)-1,3-oxaselenolan-5-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,5R)-2-(hydroxymethyl)-1,3-oxaselenolan-5-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136826771 |
| Molecular Formula | C9H10N4O3Se |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 9-[(2R,5R)-2-(hydroxymethyl)-1,3-oxaselenolan-5-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1C[Se][C@H](CO)O1 |
| InChI | InChI=1S/C9H10N4O3Se/c14-1-6-16-5(2-17-6)13-4-12-7-8(13)10-3-11-9(7)15/h3-6,14H,1-2H2,(H,10,11,15)/t5-,6-/m1/s1 |
| InChIKey | YXKMIUWRLJFPHB-PHDIDXHHSA-N |
| XLogP | -0.91 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|