C10H12N4O2S — CID 135538743
9-[(2R,5S)-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one (PubChem CID 135538743) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 9-[(2R,5S)-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,5S)-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135538743 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 9-[(2R,5S)-5-(hydroxymethyl)thiolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1CC[C@@H](CO)S1 |
| InChI | InChI=1S/C10H12N4O2S/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 |
| InChIKey | GOQUUHRTFOHDLI-NKWVEPMBSA-N |
| XLogP | 0.51 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |