C19H28FN6O10P — CID 118550517
2-[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]oxyacetic acid (PubChem CID 118550517) has the molecular formula C19H28FN6O10P and a molecular weight of 550.44 g/mol. Its IUPAC name is 2-[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]oxyacetic acid.
| Compound Name | 2-[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]oxyacetic acid |
|---|---|
| PubChem CID | 118550517 |
| Molecular Formula | C19H28FN6O10P |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]phosphoryl]oxyacetic acid |
| SMILES | COC(=O)[C@H](CC(C)C)NP(=O)(OCC(=O)O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H28FN6O10P/c1-8(2)4-9(18(31)33-3)25-37(32,35-6-11(27)28)34-5-10-13(29)14(30)17(36-10)26-7-22-12-15(21)23-19(20)24-16(12)26/h7-10,13-14,17,29-30H,4-6H2,1-3H3,(H,25,32)(H,27,28)(H2,21,23,24)/t9-,10+,13+,14-,17+,37?/m0/s1 |
| InChIKey | XYKZAVTZSOVMGL-PNODLJDKSA-N |
| XLogP | -0.43 |
| TPSA | 230.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|