C16H24FN6O8P — CID 126742868
(2S)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-methylpentanoic acid (PubChem CID 126742868) has the molecular formula C16H24FN6O8P and a molecular weight of 478.37 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 126742868 |
| Molecular Formula | C16H24FN6O8P |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (2S)-2-[[[(2R,3S,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C16H24FN6O8P/c1-6(2)3-7(15(26)27)22-32(28,29)30-4-8-10(24)11(25)14(31-8)23-5-19-9-12(18)20-16(17)21-13(9)23/h5-8,10-11,14,24-25H,3-4H2,1-2H3,(H,26,27)(H2,18,20,21)(H2,22,28,29)/t7-,8+,10+,11-,14+/m0/s1 |
| InChIKey | JLAXDOPNQODCBV-GCVBLCJJSA-N |
| XLogP | -0.63 |
| TPSA | 215.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|