C22H29ClN3O10P — CID 153237968
ethyl 2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxy-2-methylpropanoate (PubChem CID 153237968) has the molecular formula C22H29ClN3O10P and a molecular weight of 561.91 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxy-2-methylpropanoate.
| Compound Name | ethyl 2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 153237968 |
| Molecular Formula | C22H29ClN3O10P |
| Molecular Weight | 561.91 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4S,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methoxy-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(COC)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29ClN3O10P/c1-4-33-20(29)22(2,13-32-3)25-37(31,36-14-8-6-5-7-9-14)34-12-15-18(28)17(23)19(35-15)26-11-10-16(27)24-21(26)30/h5-11,15,17-19,28H,4,12-13H2,1-3H3,(H,25,31)(H,24,27,30)/t15-,17+,18-,19-,22?,37?/m1/s1 |
| InChIKey | WQWHFBKQDUOWOC-LPCAJPQSSA-N |
| XLogP | 1.16 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.91 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|