C22H28N3O10P — CID 66688126
methyl 2-[[[(4R,5R,6R,8R)-8-(2,4-dioxopyrimidin-1-yl)-5-hydroxy-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 66688126) has the molecular formula C22H28N3O10P and a molecular weight of 525.45 g/mol. Its IUPAC name is methyl 2-[[[(4R,5R,6R,8R)-8-(2,4-dioxopyrimidin-1-yl)-5-hydroxy-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[[(4R,5R,6R,8R)-8-(2,4-dioxopyrimidin-1-yl)-5-hydroxy-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 66688126 |
| Molecular Formula | C22H28N3O10P |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | methyl 2-[[[(4R,5R,6R,8R)-8-(2,4-dioxopyrimidin-1-yl)-5-hydroxy-1,7-dioxaspiro[3.4]octan-6-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@]2(CCO2)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28N3O10P/c1-21(2,19(28)31-3)24-36(30,35-14-7-5-4-6-8-14)33-13-15-17(27)22(10-12-32-22)18(34-15)25-11-9-16(26)23-20(25)29/h4-9,11,15,17-18,27H,10,12-13H2,1-3H3,(H,24,30)(H,23,26,29)/t15-,17-,18-,22-,36?/m1/s1 |
| InChIKey | GEOSVHQVGZIMFB-IHCGESCNSA-N |
| XLogP | 0.70 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|