C22H28BClN3O9P — CID 146815025
CID 146815025 (PubChem CID 146815025) has the molecular formula C22H28BClN3O9P and a molecular weight of 555.72 g/mol.
| Compound Name | CID 146815025 |
|---|---|
| PubChem CID | 146815025 |
| Molecular Formula | C22H28BClN3O9P |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | — |
| SMILES | [B][C@]1(Cl)[C@H](O)[C@@H](CO[P@](=O)(NC(C)(C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28BClN3O9P/c1-13(2)34-19(30)21(3,4)26-37(32,36-14-8-6-5-7-9-14)33-12-15-17(29)22(23,24)18(35-15)27-11-10-16(28)25-20(27)31/h5-11,13,15,17-18,29H,12H2,1-4H3,(H,26,32)(H,25,28,31)/t15-,17-,18-,22+,37-/m1/s1 |
| InChIKey | BENXYYVQYBOZHZ-OYVVVWNXSA-N |
| XLogP | 1.42 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|