C22H27ClN3O9P — CID 126675975
ethyl 2-[[[(1R,3R,4R,5R)-5-chloro-1-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 126675975) has the molecular formula C22H27ClN3O9P and a molecular weight of 543.90 g/mol. Its IUPAC name is ethyl 2-[[[(1R,3R,4R,5R)-5-chloro-1-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[[(1R,3R,4R,5R)-5-chloro-1-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 126675975 |
| Molecular Formula | C22H27ClN3O9P |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | ethyl 2-[[[(1R,3R,4R,5R)-5-chloro-1-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NP(=O)(OC[C@H]1O[C@]2(n3ccc(=O)[nH]c3=O)C[C@@]2(Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H27ClN3O9P/c1-4-32-18(29)20(2,3)25-36(31,35-14-8-6-5-7-9-14)33-12-15-17(28)21(23)13-22(21,34-15)26-11-10-16(27)24-19(26)30/h5-11,15,17,28H,4,12-13H2,1-3H3,(H,25,31)(H,24,27,30)/t15-,17-,21-,22-,36?/m1/s1 |
| InChIKey | KASAVEPENFQBMO-CERBSRFGSA-N |
| XLogP | 1.47 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|