C24H31N6O8P — CID 166684664
ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 166684664) has the molecular formula C24H31N6O8P and a molecular weight of 562.52 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 166684664 |
| Molecular Formula | C24H31N6O8P |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | ethyl 2-[[[(2R,3S,4R,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NP(=O)(OC[C@H]1O[C@@](C#N)(C2CC=C3C(N)=NC=NN32)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H31N6O8P/c1-4-35-22(33)23(2,3)29-39(34,38-15-8-6-5-7-9-15)36-12-17-19(31)20(32)24(13-25,37-17)18-11-10-16-21(26)27-14-28-30(16)18/h5-10,14,17-20,31-32H,4,11-12H2,1-3H3,(H,29,34)(H2,26,27,28)/t17-,18?,19-,20-,24+,39?/m1/s1 |
| InChIKey | UUCWNZPHBFFPHW-ZLTPDLPKSA-N |
| XLogP | 0.78 |
| TPSA | 201.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|