C23H31N6O8P — CID 170219445
methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170219445) has the molecular formula C23H31N6O8P and a molecular weight of 550.51 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170219445 |
| Molecular Formula | C23H31N6O8P |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C/N=C/[C@]1(CO[P@@](=O)(N[C@@H](C)C(=O)OC)Oc2ccccc2)O[C@@H](C2CC=C3C(N)=NC=NN32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H31N6O8P/c1-14(22(32)34-3)28-38(33,37-15-7-5-4-6-8-15)35-12-23(11-25-2)20(31)18(30)19(36-23)16-9-10-17-21(24)26-13-27-29(16)17/h4-8,10-11,13-14,16,18-20,30-31H,9,12H2,1-3H3,(H,28,33)(H2,24,26,27)/b25-11+/t14-,16?,18-,19-,20-,23+,38-/m0/s1 |
| InChIKey | QDVTURLRUDDGRB-XPBWOORLSA-N |
| XLogP | 0.17 |
| TPSA | 189.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|