C29H40F2N4O8 — CID 129048106
[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-hydroxy-4-(pentoxycarbonylamino)-2H-pyrimidin-1-yl]oxolan-2-yl]methyl 8-anilino-8-oxooctanoate (PubChem CID 129048106) has the molecular formula C29H40F2N4O8 and a molecular weight of 610.66 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-hydroxy-4-(pentoxycarbonylamino)-2H-pyrimidin-1-yl]oxolan-2-yl]methyl 8-anilino-8-oxooctanoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-hydroxy-4-(pentoxycarbonylamino)-2H-pyrimidin-1-yl]oxolan-2-yl]methyl 8-anilino-8-oxooctanoate |
|---|---|
| PubChem CID | 129048106 |
| Molecular Formula | C29H40F2N4O8 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-hydroxy-4-(pentoxycarbonylamino)-2H-pyrimidin-1-yl]oxolan-2-yl]methyl 8-anilino-8-oxooctanoate |
| SMILES | CCCCCOC(=O)NC1=NC(O)N([C@@H]2O[C@H](COC(=O)CCCCCCC(=O)Nc3ccccc3)[C@@H](O)C2(F)F)C=C1 |
| InChI | InChI=1S/C29H40F2N4O8/c1-2-3-11-18-41-28(40)34-22-16-17-35(27(39)33-22)26-29(30,31)25(38)21(43-26)19-42-24(37)15-10-5-4-9-14-23(36)32-20-12-7-6-8-13-20/h6-8,12-13,16-17,21,25-27,38-39H,2-5,9-11,14-15,18-19H2,1H3,(H,32,36)(H,33,34,40)/t21-,25-,26-,27?/m1/s1 |
| InChIKey | KZZZWNRGHYYTKR-WJTNKFQJSA-N |
| XLogP | 3.65 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|