C29H41F2N3O5 — CID 155377486
(5E,8E,11E,14E,17Z)-N-[1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-2H-pyrimidin-4-yl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 155377486) has the molecular formula C29H41F2N3O5 and a molecular weight of 549.66 g/mol. Its IUPAC name is (5E,8E,11E,14E,17Z)-N-[1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-2H-pyrimidin-4-yl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5E,8E,11E,14E,17Z)-N-[1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-2H-pyrimidin-4-yl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 155377486 |
| Molecular Formula | C29H41F2N3O5 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | (5E,8E,11E,14E,17Z)-N-[1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-2H-pyrimidin-4-yl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)NC1=NC(O)N(C2OC(CO)C(O)C2(F)F)C=C1 |
| InChI | InChI=1S/C29H41F2N3O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(36)32-24-20-21-34(28(38)33-24)27-29(30,31)26(37)23(22-35)39-27/h3-4,6-7,9-10,12-13,15-16,20-21,23,26-28,35,37-38H,2,5,8,11,14,17-19,22H2,1H3,(H,32,33,36)/b4-3-,7-6+,10-9+,13-12+,16-15+ |
| InChIKey | RBEUBCRSALEBRC-XLUYNVTMSA-N |
| XLogP | 4.24 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|